C28H46N2OSi — CID 19750803
1-[4-(dipropylamino)-1-tri(propan-2-yl)silyl-4,5-dihydro-3H-benzo[cd]indol-6-yl]ethanone (PubChem CID 19750803) has the molecular formula C28H46N2OSi and a molecular weight of 454.78 g/mol. Its IUPAC name is 1-[4-(dipropylamino)-1-tri(propan-2-yl)silyl-4,5-dihydro-3H-benzo[cd]indol-6-yl]ethanone.
| Compound Name | 1-[4-(dipropylamino)-1-tri(propan-2-yl)silyl-4,5-dihydro-3H-benzo[cd]indol-6-yl]ethanone |
|---|---|
| PubChem CID | 19750803 |
| Molecular Formula | C28H46N2OSi |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | 1-[4-(dipropylamino)-1-tri(propan-2-yl)silyl-4,5-dihydro-3H-benzo[cd]indol-6-yl]ethanone |
| SMILES | CCCN(CCC)C1Cc2cn([Si](C(C)C)(C(C)C)C(C)C)c3ccc(C(C)=O)c(c23)C1 |
| InChI | InChI=1S/C28H46N2OSi/c1-10-14-29(15-11-2)24-16-23-18-30(32(19(3)4,20(5)6)21(7)8)27-13-12-25(22(9)31)26(17-24)28(23)27/h12-13,18-21,24H,10-11,14-17H2,1-9H3 |
| InChIKey | LORQKMQWRPCWOW-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|