C29H52N2SiSn — CID 11455931
(4S)-N,N-dipropyl-6-trimethylstannyl-1-tri(propan-2-yl)silyl-4,5-dihydro-3H-benzo[cd]indol-4-amine (PubChem CID 11455931) has the molecular formula C29H52N2SiSn and a molecular weight of 575.55 g/mol. Its IUPAC name is (4S)-N,N-dipropyl-6-trimethylstannyl-1-tri(propan-2-yl)silyl-4,5-dihydro-3H-benzo[cd]indol-4-amine.
| Compound Name | (4S)-N,N-dipropyl-6-trimethylstannyl-1-tri(propan-2-yl)silyl-4,5-dihydro-3H-benzo[cd]indol-4-amine |
|---|---|
| PubChem CID | 11455931 |
| Molecular Formula | C29H52N2SiSn |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | (4S)-N,N-dipropyl-6-trimethylstannyl-1-tri(propan-2-yl)silyl-4,5-dihydro-3H-benzo[cd]indol-4-amine |
| SMILES | CCCN(CCC)[C@H]1Cc2cn([Si](C(C)C)(C(C)C)C(C)C)c3ccc([Sn](C)(C)C)c(c23)C1 |
| InChI | InChI=1S/C26H43N2Si.3CH3.Sn/c1-9-14-27(15-10-2)24-16-22-12-11-13-25-26(22)23(17-24)18-28(25)29(19(3)4,20(5)6)21(7)8;;;;/h11,13,18-21,24H,9-10,14-17H2,1-8H3;3*1H3;/t24-;;;;/m1..../s1 |
| InChIKey | OACORJVHLZJAKW-YATFKFJDSA-N |
| XLogP | 7.80 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|