C19H27N3O5 — CID 18654098
carboxy-[(2S)-6-(4-methylpiperidin-1-yl)-6-oxo-1-pyridin-2-ylhexan-2-yl]carbamic acid (PubChem CID 18654098) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is carboxy-[(2S)-6-(4-methylpiperidin-1-yl)-6-oxo-1-pyridin-2-ylhexan-2-yl]carbamic acid.
| Compound Name | carboxy-[(2S)-6-(4-methylpiperidin-1-yl)-6-oxo-1-pyridin-2-ylhexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 18654098 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | carboxy-[(2S)-6-(4-methylpiperidin-1-yl)-6-oxo-1-pyridin-2-ylhexan-2-yl]carbamic acid |
| SMILES | CC1CCN(C(=O)CCC[C@@H](Cc2ccccn2)N(C(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C19H27N3O5/c1-14-8-11-21(12-9-14)17(23)7-4-6-16(22(18(24)25)19(26)27)13-15-5-2-3-10-20-15/h2-3,5,10,14,16H,4,6-9,11-13H2,1H3,(H,24,25)(H,26,27)/t16-/m0/s1 |
| InChIKey | ZLEOYCQRGZQAGX-INIZCTEOSA-N |
| XLogP | 3.08 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |