C25H41NO4 — CID 18655991
N-[(1S)-1-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl]heptan-1-amine (PubChem CID 18655991) has the molecular formula C25H41NO4 and a molecular weight of 419.61 g/mol. Its IUPAC name is N-[(1S)-1-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl]heptan-1-amine.
| Compound Name | N-[(1S)-1-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl]heptan-1-amine |
|---|---|
| PubChem CID | 18655991 |
| Molecular Formula | C25H41NO4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | N-[(1S)-1-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl]heptan-1-amine |
| SMILES | CCCCCCCN[C@@H](C)[C@H]1O[C@H](OCCCc2ccccc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C25H41NO4/c1-5-6-7-8-12-17-26-19(2)21-22-23(30-25(3,4)29-22)24(28-21)27-18-13-16-20-14-10-9-11-15-20/h9-11,14-15,19,21-24,26H,5-8,12-13,16-18H2,1-4H3/t19-,21+,22-,23-,24-/m0/s1 |
| InChIKey | XDPVWZAERSSNDP-FGQYTZQDSA-N |
| XLogP | 4.83 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|