C12H15NO5 — CID 18657706
methyl (1S,6S)-6-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclohex-3-ene-1-carboxylate (PubChem CID 18657706) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is methyl (1S,6S)-6-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,6S)-6-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 18657706 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | methyl (1S,6S)-6-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC=CC[C@@H]1C(=O)N1CCOC1=O |
| InChI | InChI=1S/C12H15NO5/c1-17-11(15)9-5-3-2-4-8(9)10(14)13-6-7-18-12(13)16/h2-3,8-9H,4-7H2,1H3/t8-,9-/m0/s1 |
| InChIKey | MUGWLLYNEAVVIB-IUCAKERBSA-N |
| XLogP | 0.72 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|