C15H29N5O3 — CID 18659590
(2S)-2-acetamido-N-[(E)-(carbamoylhydrazinylidene)methyl]-4-methyl-N-pentylpentanamide (PubChem CID 18659590) has the molecular formula C15H29N5O3 and a molecular weight of 327.43 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(E)-(carbamoylhydrazinylidene)methyl]-4-methyl-N-pentylpentanamide.
| Compound Name | (2S)-2-acetamido-N-[(E)-(carbamoylhydrazinylidene)methyl]-4-methyl-N-pentylpentanamide |
|---|---|
| PubChem CID | 18659590 |
| Molecular Formula | C15H29N5O3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | (2S)-2-acetamido-N-[(E)-(carbamoylhydrazinylidene)methyl]-4-methyl-N-pentylpentanamide |
| SMILES | CCCCCN(/C=N/NC(N)=O)C(=O)[C@H](CC(C)C)NC(C)=O |
| InChI | InChI=1S/C15H29N5O3/c1-5-6-7-8-20(10-17-19-15(16)23)14(22)13(9-11(2)3)18-12(4)21/h10-11,13H,5-9H2,1-4H3,(H,18,21)(H3,16,19,23)/b17-10+/t13-/m0/s1 |
| InChIKey | YIKXDNQUJVTVNN-VZWMTCDZSA-N |
| XLogP | 1.17 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|