C24H41Cl2N5O2 — CID 18665290
(2S,3aS,7aS)-1-[(2S)-2-(cyclohexylamino)propanoyl]-N-[3-(1H-imidazol-5-yl)propyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide;dihydrochloride (PubChem CID 18665290) has the molecular formula C24H41Cl2N5O2 and a molecular weight of 502.53 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[(2S)-2-(cyclohexylamino)propanoyl]-N-[3-(1H-imidazol-5-yl)propyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide;dihydrochloride.
| Compound Name | (2S,3aS,7aS)-1-[(2S)-2-(cyclohexylamino)propanoyl]-N-[3-(1H-imidazol-5-yl)propyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 18665290 |
| Molecular Formula | C24H41Cl2N5O2 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | (2S,3aS,7aS)-1-[(2S)-2-(cyclohexylamino)propanoyl]-N-[3-(1H-imidazol-5-yl)propyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide;dihydrochloride |
| SMILES | C[C@H](NC1CCCCC1)C(=O)N1[C@H](C(=O)NCCCc2cnc[nH]2)C[C@@H]2CCCC[C@@H]21.Cl.Cl |
| InChI | InChI=1S/C24H39N5O2.2ClH/c1-17(28-19-9-3-2-4-10-19)24(31)29-21-12-6-5-8-18(21)14-22(29)23(30)26-13-7-11-20-15-25-16-27-20;;/h15-19,21-22,28H,2-14H2,1H3,(H,25,27)(H,26,30);2*1H/t17-,18-,21-,22-;;/m0../s1 |
| InChIKey | BZADOBFIUGQBGI-ROAMXDEOSA-N |
| XLogP | 3.77 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|