C21H25NS — CID 18665605
(3R,5S)-3-[(E)-but-2-enyl]-3-ethyl-5-phenyl-4,5-dihydro-2H-1,4-benzothiazepine (PubChem CID 18665605) has the molecular formula C21H25NS and a molecular weight of 323.51 g/mol. Its IUPAC name is (3R,5S)-3-[(E)-but-2-enyl]-3-ethyl-5-phenyl-4,5-dihydro-2H-1,4-benzothiazepine.
| Compound Name | (3R,5S)-3-[(E)-but-2-enyl]-3-ethyl-5-phenyl-4,5-dihydro-2H-1,4-benzothiazepine |
|---|---|
| PubChem CID | 18665605 |
| Molecular Formula | C21H25NS |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (3R,5S)-3-[(E)-but-2-enyl]-3-ethyl-5-phenyl-4,5-dihydro-2H-1,4-benzothiazepine |
| SMILES | C/C=C/C[C@]1(CC)CSc2ccccc2[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C21H25NS/c1-3-5-15-21(4-2)16-23-19-14-10-9-13-18(19)20(22-21)17-11-7-6-8-12-17/h3,5-14,20,22H,4,15-16H2,1-2H3/b5-3+/t20-,21+/m0/s1 |
| InChIKey | NJCUKQJWUDWPIP-AGPAGUAHSA-N |
| XLogP | 5.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|