C21H21NO3S — CID 18665641
(E)-1-(dioxiran-3-yl)-3-[(3S,5S)-3-ethyl-5-phenyl-4,5-dihydro-2H-1,4-benzothiazepin-3-yl]prop-2-en-1-one (PubChem CID 18665641) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is (E)-1-(dioxiran-3-yl)-3-[(3S,5S)-3-ethyl-5-phenyl-4,5-dihydro-2H-1,4-benzothiazepin-3-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(dioxiran-3-yl)-3-[(3S,5S)-3-ethyl-5-phenyl-4,5-dihydro-2H-1,4-benzothiazepin-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 18665641 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (E)-1-(dioxiran-3-yl)-3-[(3S,5S)-3-ethyl-5-phenyl-4,5-dihydro-2H-1,4-benzothiazepin-3-yl]prop-2-en-1-one |
| SMILES | CC[C@]1(/C=C/C(=O)C2OO2)CSc2ccccc2[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C21H21NO3S/c1-2-21(13-12-17(23)20-24-25-20)14-26-18-11-7-6-10-16(18)19(22-21)15-8-4-3-5-9-15/h3-13,19-20,22H,2,14H2,1H3/b13-12+/t19-,21-/m0/s1 |
| InChIKey | LZMSCFXTLVJNQW-LMULYTEMSA-N |
| XLogP | 4.03 |
| TPSA | 54.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|