C21H40O3Si — CID 18666364
(4R)-4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanoic acid (PubChem CID 18666364) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is (4R)-4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanoic acid.
| Compound Name | (4R)-4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 18666364 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (4R)-4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C21H40O3Si/c1-15(10-13-19(22)23)16-11-12-17-18(9-8-14-21(16,17)5)24-25(6,7)20(2,3)4/h15-18H,8-14H2,1-7H3,(H,22,23)/t15-,16-,17+,18+,21-/m1/s1 |
| InChIKey | IPZHTEXTQKGYCF-YXZMJPADSA-N |
| XLogP | 6.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|