C18H20N2O4 — CID 18668271
4-[(5-hydroxynaphthalen-1-yl)carbamoylamino]butyl prop-2-enoate (PubChem CID 18668271) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-[(5-hydroxynaphthalen-1-yl)carbamoylamino]butyl prop-2-enoate.
| Compound Name | 4-[(5-hydroxynaphthalen-1-yl)carbamoylamino]butyl prop-2-enoate |
|---|---|
| PubChem CID | 18668271 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 4-[(5-hydroxynaphthalen-1-yl)carbamoylamino]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCNC(=O)Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C18H20N2O4/c1-2-17(22)24-12-4-3-11-19-18(23)20-15-9-5-8-14-13(15)7-6-10-16(14)21/h2,5-10,21H,1,3-4,11-12H2,(H2,19,20,23) |
| InChIKey | FXMUWJJGBNLRDU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|