C16H15N2O4- — CID 18935952
4-[(5-hydroxynaphthalen-1-yl)carbamoylamino]-2-methylidenebutanoate (PubChem CID 18935952) has the molecular formula C16H15N2O4- and a molecular weight of 299.31 g/mol. Its IUPAC name is 4-[(5-hydroxynaphthalen-1-yl)carbamoylamino]-2-methylidenebutanoate.
| Compound Name | 4-[(5-hydroxynaphthalen-1-yl)carbamoylamino]-2-methylidenebutanoate |
|---|---|
| PubChem CID | 18935952 |
| Molecular Formula | C16H15N2O4- |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-[(5-hydroxynaphthalen-1-yl)carbamoylamino]-2-methylidenebutanoate |
| SMILES | C=C(CCNC(=O)Nc1cccc2c(O)cccc12)C(=O)[O-] |
| InChI | InChI=1S/C16H16N2O4/c1-10(15(20)21)8-9-17-16(22)18-13-6-2-5-12-11(13)4-3-7-14(12)19/h2-7,19H,1,8-9H2,(H,20,21)(H2,17,18,22)/p-1 |
| InChIKey | VICSIFCXGJMULE-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|