C19H12F2O5S — CID 18669516
5-(2,4-difluorophenyl)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-carbaldehyde (PubChem CID 18669516) has the molecular formula C19H12F2O5S and a molecular weight of 390.36 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-carbaldehyde.
| Compound Name | 5-(2,4-difluorophenyl)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-carbaldehyde |
|---|---|
| PubChem CID | 18669516 |
| Molecular Formula | C19H12F2O5S |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 5-(2,4-difluorophenyl)-6-(4-methylsulfonylphenyl)-4-oxopyran-2-carbaldehyde |
| SMILES | CS(=O)(=O)c1ccc(-c2oc(C=O)cc(=O)c2-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H12F2O5S/c1-27(24,25)14-5-2-11(3-6-14)19-18(17(23)9-13(10-22)26-19)15-7-4-12(20)8-16(15)21/h2-10H,1H3 |
| InChIKey | VCRWZXBQQVDLIS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 81.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|