C13H15F15O3Si — CID 18671048
trimethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorodecyl)silane (PubChem CID 18671048) has the molecular formula C13H15F15O3Si and a molecular weight of 532.32 g/mol. Its IUPAC name is trimethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorodecyl)silane.
| Compound Name | trimethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorodecyl)silane |
|---|---|
| PubChem CID | 18671048 |
| Molecular Formula | C13H15F15O3Si |
| Molecular Weight | 532.32 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | trimethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorodecyl)silane |
| SMILES | CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)[Si](OC)(OC)OC |
| InChI | InChI=1S/C13H15F15O3Si/c1-5-7(15,16)9(19,20)11(23,24)13(27,28)12(25,26)10(21,22)8(17,18)6(14)32(29-2,30-3)31-4/h6H,5H2,1-4H3 |
| InChIKey | DLJJEUSBVWZLAK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.32 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|