C23H24N2O2 — CID 18672579
N-[2-[2-(dimethylamino)ethoxy]phenyl]-4-phenylbenzamide (PubChem CID 18672579) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethoxy]phenyl]-4-phenylbenzamide.
| Compound Name | N-[2-[2-(dimethylamino)ethoxy]phenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 18672579 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethoxy]phenyl]-4-phenylbenzamide |
| SMILES | CN(C)CCOc1ccccc1NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O2/c1-25(2)16-17-27-22-11-7-6-10-21(22)24-23(26)20-14-12-19(13-15-20)18-8-4-3-5-9-18/h3-15H,16-17H2,1-2H3,(H,24,26) |
| InChIKey | XKJVUFZGVIXCSS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |