C15H10N2O5 — CID 18674703
3-[2-(3,4-dihydroxy-5-nitrophenyl)-2-oxoethyl]benzonitrile (PubChem CID 18674703) has the molecular formula C15H10N2O5 and a molecular weight of 298.25 g/mol. Its IUPAC name is 3-[2-(3,4-dihydroxy-5-nitrophenyl)-2-oxoethyl]benzonitrile.
| Compound Name | 3-[2-(3,4-dihydroxy-5-nitrophenyl)-2-oxoethyl]benzonitrile |
|---|---|
| PubChem CID | 18674703 |
| Molecular Formula | C15H10N2O5 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 3-[2-(3,4-dihydroxy-5-nitrophenyl)-2-oxoethyl]benzonitrile |
| SMILES | N#Cc1cccc(CC(=O)c2cc(O)c(O)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C15H10N2O5/c16-8-10-3-1-2-9(4-10)5-13(18)11-6-12(17(21)22)15(20)14(19)7-11/h1-4,6-7,19-20H,5H2 |
| InChIKey | COIOOUVJBPHQIZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 124.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|