C17H31N3 — CID 18678121
7-[(5Z)-cyclodec-5-en-1-yl]-4,5,6,8,9,10-hexahydro-1H-1,3,7-triazecine (PubChem CID 18678121) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is 7-[(5Z)-cyclodec-5-en-1-yl]-4,5,6,8,9,10-hexahydro-1H-1,3,7-triazecine.
| Compound Name | 7-[(5Z)-cyclodec-5-en-1-yl]-4,5,6,8,9,10-hexahydro-1H-1,3,7-triazecine |
|---|---|
| PubChem CID | 18678121 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | 7-[(5Z)-cyclodec-5-en-1-yl]-4,5,6,8,9,10-hexahydro-1H-1,3,7-triazecine |
| SMILES | C1=C\CCCC(N2CCC/N=C\NCCC2)CCCC/1 |
| InChI | InChI=1S/C17H31N3/c1-2-4-6-10-17(11-7-5-3-1)20-14-8-12-18-16-19-13-9-15-20/h1-2,16-17H,3-15H2,(H,18,19)/b2-1- |
| InChIKey | LRMYQHYVEDFJDF-UPHRSURJSA-N |
| XLogP | 3.37 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|