C18H22N4O10 — CID 18683724
ethyl 3-[[3-[[(3-ethoxy-2-nitro-3-oxopropanoyl)amino]methyl]phenyl]methylamino]-2-nitro-3-oxopropanoate (PubChem CID 18683724) has the molecular formula C18H22N4O10 and a molecular weight of 454.39 g/mol. Its IUPAC name is ethyl 3-[[3-[[(3-ethoxy-2-nitro-3-oxopropanoyl)amino]methyl]phenyl]methylamino]-2-nitro-3-oxopropanoate.
| Compound Name | ethyl 3-[[3-[[(3-ethoxy-2-nitro-3-oxopropanoyl)amino]methyl]phenyl]methylamino]-2-nitro-3-oxopropanoate |
|---|---|
| PubChem CID | 18683724 |
| Molecular Formula | C18H22N4O10 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | ethyl 3-[[3-[[(3-ethoxy-2-nitro-3-oxopropanoyl)amino]methyl]phenyl]methylamino]-2-nitro-3-oxopropanoate |
| SMILES | CCOC(=O)C(C(=O)NCc1cccc(CNC(=O)C(C(=O)OCC)[N+](=O)[O-])c1)[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N4O10/c1-3-31-17(25)13(21(27)28)15(23)19-9-11-6-5-7-12(8-11)10-20-16(24)14(22(29)30)18(26)32-4-2/h5-8,13-14H,3-4,9-10H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | WSPSKJAEGXMGTE-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 197.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|