C23H34O4 — CID 18684347
tert-butyl 3-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]oxy-3-(2-bicyclo[2.2.1]hept-5-enyl)propanoate (PubChem CID 18684347) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is tert-butyl 3-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]oxy-3-(2-bicyclo[2.2.1]hept-5-enyl)propanoate.
| Compound Name | tert-butyl 3-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]oxy-3-(2-bicyclo[2.2.1]hept-5-enyl)propanoate |
|---|---|
| PubChem CID | 18684347 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | tert-butyl 3-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]oxy-3-(2-bicyclo[2.2.1]hept-5-enyl)propanoate |
| SMILES | CC(C)(C)OC(=O)CC(OC(=O)CC1CC2CCC1C2)C1CC2C=CC1C2 |
| InChI | InChI=1S/C23H34O4/c1-23(2,3)27-22(25)13-20(19-11-15-5-7-17(19)9-15)26-21(24)12-18-10-14-4-6-16(18)8-14/h5,7,14-20H,4,6,8-13H2,1-3H3 |
| InChIKey | TXQIJUOBUMNLSQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|