C16H11Cl2NO3S — CID 18684374
1-(3,5-dichloro-4-hydroxyphenyl)sulfinamoyloxynaphthalene (PubChem CID 18684374) has the molecular formula C16H11Cl2NO3S and a molecular weight of 368.24 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-hydroxyphenyl)sulfinamoyloxynaphthalene.
| Compound Name | 1-(3,5-dichloro-4-hydroxyphenyl)sulfinamoyloxynaphthalene |
|---|---|
| PubChem CID | 18684374 |
| Molecular Formula | C16H11Cl2NO3S |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 1-(3,5-dichloro-4-hydroxyphenyl)sulfinamoyloxynaphthalene |
| SMILES | O=S(Nc1cc(Cl)c(O)c(Cl)c1)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C16H11Cl2NO3S/c17-13-8-11(9-14(18)16(13)20)19-23(21)22-15-7-3-5-10-4-1-2-6-12(10)15/h1-9,19-20H |
| InChIKey | HBMLMZJRUMNAQS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|