C16H18ClNO6S — CID 20665642
1-chloro-2-hydroxy-4,5-dimethoxy-3-[(2-methoxy-4-methylphenoxy)sulfinylamino]benzene (PubChem CID 20665642) has the molecular formula C16H18ClNO6S and a molecular weight of 387.84 g/mol. Its IUPAC name is 1-chloro-2-hydroxy-4,5-dimethoxy-3-[(2-methoxy-4-methylphenoxy)sulfinylamino]benzene.
| Compound Name | 1-chloro-2-hydroxy-4,5-dimethoxy-3-[(2-methoxy-4-methylphenoxy)sulfinylamino]benzene |
|---|---|
| PubChem CID | 20665642 |
| Molecular Formula | C16H18ClNO6S |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 1-chloro-2-hydroxy-4,5-dimethoxy-3-[(2-methoxy-4-methylphenoxy)sulfinylamino]benzene |
| SMILES | COc1cc(C)ccc1OS(=O)Nc1c(O)c(Cl)cc(OC)c1OC |
| InChI | InChI=1S/C16H18ClNO6S/c1-9-5-6-11(12(7-9)21-2)24-25(20)18-14-15(19)10(17)8-13(22-3)16(14)23-4/h5-8,18-19H,1-4H3 |
| InChIKey | KZDKMTKLMUBRHQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|