C18H25ClO2 — CID 18687695
1-(8-tert-butyl-3,4-dihydro-2H-chromen-6-yl)-3-chloro-3-methylbutan-1-one (PubChem CID 18687695) has the molecular formula C18H25ClO2 and a molecular weight of 308.85 g/mol. Its IUPAC name is 1-(8-tert-butyl-3,4-dihydro-2H-chromen-6-yl)-3-chloro-3-methylbutan-1-one.
| Compound Name | 1-(8-tert-butyl-3,4-dihydro-2H-chromen-6-yl)-3-chloro-3-methylbutan-1-one |
|---|---|
| PubChem CID | 18687695 |
| Molecular Formula | C18H25ClO2 |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-(8-tert-butyl-3,4-dihydro-2H-chromen-6-yl)-3-chloro-3-methylbutan-1-one |
| SMILES | CC(C)(Cl)CC(=O)c1cc2c(c(C(C)(C)C)c1)OCCC2 |
| InChI | InChI=1S/C18H25ClO2/c1-17(2,3)14-10-13(15(20)11-18(4,5)19)9-12-7-6-8-21-16(12)14/h9-10H,6-8,11H2,1-5H3 |
| InChIKey | RKGJPCYUQMZYIS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|