C19H28O2S — CID 22905863
1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-3-methyl-3-sulfanylbutan-1-one (PubChem CID 22905863) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-3-methyl-3-sulfanylbutan-1-one.
| Compound Name | 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-3-methyl-3-sulfanylbutan-1-one |
|---|---|
| PubChem CID | 22905863 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-3-methyl-3-sulfanylbutan-1-one |
| SMILES | CC(C)(S)CC(=O)c1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2 |
| InChI | InChI=1S/C19H28O2S/c1-17(2,3)13-8-12(15(20)10-19(6,7)22)9-14-16(13)21-11-18(14,4)5/h8-9,22H,10-11H2,1-7H3 |
| InChIKey | CMZRYQPMOHISBC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|