C14H19BrO — CID 134205934
5-bromo-8-tert-butyl-6-methyl-3,4-dihydro-2H-chromene (PubChem CID 134205934) has the molecular formula C14H19BrO and a molecular weight of 283.21 g/mol. Its IUPAC name is 5-bromo-8-tert-butyl-6-methyl-3,4-dihydro-2H-chromene.
| Compound Name | 5-bromo-8-tert-butyl-6-methyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 134205934 |
| Molecular Formula | C14H19BrO |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-bromo-8-tert-butyl-6-methyl-3,4-dihydro-2H-chromene |
| SMILES | Cc1cc(C(C)(C)C)c2c(c1Br)CCCO2 |
| InChI | InChI=1S/C14H19BrO/c1-9-8-11(14(2,3)4)13-10(12(9)15)6-5-7-16-13/h8H,5-7H2,1-4H3 |
| InChIKey | UGNJBJRPDLMQAG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |