About 4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde
4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde (PubChem CID 142236889) has the molecular formula C10H9BrO2
and a molecular weight of 241.08 g/mol. Its IUPAC name is 4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde |
| PubChem CID | 142236889 |
| Molecular Formula | C10H9BrO2 |
| Molecular Weight | 241.08 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde |
| SMILES | Cc1cc(C=O)c(Br)c2c1OCC2 |
| InChI | InChI=1S/C10H9BrO2/c1-6-4-7(5-12)9(11)8-2-3-13-10(6)8/h4-5H,2-3H2,1H3 |
| InChIKey | PQFNPMKRCNCUHA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.08 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde?
The IUPAC name of 4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde (CID 142236889) is 4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde.
What is the SMILES notation for 4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde?
The canonical SMILES for 4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde is Cc1cc(C=O)c(Br)c2c1OCC2.
What is the InChIKey of 4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde?
The InChIKey is PQFNPMKRCNCUHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrO2/c1-6-4-7(5-12)9(11)8-2-3-13-10(6)8/h4-5H,2-3H2,1H3.
What are the key properties of 4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde?
4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde has a molecular weight of 241.08 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-7-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde is sourced from PubChem (CID 142236889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).