C19H24N4O7 — CID 18695442
tert-butyl 2-[4-(2-ethoxy-2-oxoethoxy)-5-imidazol-1-yl-2-nitroanilino]acetate (PubChem CID 18695442) has the molecular formula C19H24N4O7 and a molecular weight of 420.42 g/mol. Its IUPAC name is tert-butyl 2-[4-(2-ethoxy-2-oxoethoxy)-5-imidazol-1-yl-2-nitroanilino]acetate.
| Compound Name | tert-butyl 2-[4-(2-ethoxy-2-oxoethoxy)-5-imidazol-1-yl-2-nitroanilino]acetate |
|---|---|
| PubChem CID | 18695442 |
| Molecular Formula | C19H24N4O7 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | tert-butyl 2-[4-(2-ethoxy-2-oxoethoxy)-5-imidazol-1-yl-2-nitroanilino]acetate |
| SMILES | CCOC(=O)COc1cc([N+](=O)[O-])c(NCC(=O)OC(C)(C)C)cc1-n1ccnc1 |
| InChI | InChI=1S/C19H24N4O7/c1-5-28-18(25)11-29-16-9-14(23(26)27)13(8-15(16)22-7-6-20-12-22)21-10-17(24)30-19(2,3)4/h6-9,12,21H,5,10-11H2,1-4H3 |
| InChIKey | OCBIWFSABXUVLH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|