C27H33ClN4O4S — CID 18695969
2-[4-[4-(3-butyl-2-oxobenzimidazol-1-yl)piperidin-1-yl]butyl]-5-chloro-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 18695969) has the molecular formula C27H33ClN4O4S and a molecular weight of 545.11 g/mol. Its IUPAC name is 2-[4-[4-(3-butyl-2-oxobenzimidazol-1-yl)piperidin-1-yl]butyl]-5-chloro-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[4-[4-(3-butyl-2-oxobenzimidazol-1-yl)piperidin-1-yl]butyl]-5-chloro-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 18695969 |
| Molecular Formula | C27H33ClN4O4S |
| Molecular Weight | 545.11 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 2-[4-[4-(3-butyl-2-oxobenzimidazol-1-yl)piperidin-1-yl]butyl]-5-chloro-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CCCCn1c(=O)n(C2CCN(CCCCN3C(=O)c4cc(Cl)ccc4S3(=O)=O)CC2)c2ccccc21 |
| InChI | InChI=1S/C27H33ClN4O4S/c1-2-3-15-30-23-8-4-5-9-24(23)32(27(30)34)21-12-17-29(18-13-21)14-6-7-16-31-26(33)22-19-20(28)10-11-25(22)37(31,35)36/h4-5,8-11,19,21H,2-3,6-7,12-18H2,1H3 |
| InChIKey | XCFCXWYSOCEYHZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.11 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|