C23H24ClN3O5S — CID 19085835
3-[1-[4-(4-chloro-1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one (PubChem CID 19085835) has the molecular formula C23H24ClN3O5S and a molecular weight of 489.98 g/mol. Its IUPAC name is 3-[1-[4-(4-chloro-1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[1-[4-(4-chloro-1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 19085835 |
| Molecular Formula | C23H24ClN3O5S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 3-[1-[4-(4-chloro-1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one |
| SMILES | O=C1c2c(Cl)cccc2S(=O)(=O)N1CCCCN1CCC(n2c(=O)oc3ccccc32)CC1 |
| InChI | InChI=1S/C23H24ClN3O5S/c24-17-6-5-9-20-21(17)22(28)26(33(20,30)31)13-4-3-12-25-14-10-16(11-15-25)27-18-7-1-2-8-19(18)32-23(27)29/h1-2,5-9,16H,3-4,10-15H2 |
| InChIKey | MOMYBTCVOTXAPL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 92.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|