C26H33N3O5S — CID 67657551
3-[1-[4-(1,1-dihydroxy-3-oxo-5-propan-2-yl-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one (PubChem CID 67657551) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is 3-[1-[4-(1,1-dihydroxy-3-oxo-5-propan-2-yl-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[1-[4-(1,1-dihydroxy-3-oxo-5-propan-2-yl-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 67657551 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 3-[1-[4-(1,1-dihydroxy-3-oxo-5-propan-2-yl-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one |
| SMILES | CC(C)c1ccc2c(c1)C(=O)N(CCCCN1CCC(n3c(=O)oc4ccccc43)CC1)S2(O)O |
| InChI | InChI=1S/C26H33N3O5S/c1-18(2)19-9-10-24-21(17-19)25(30)28(35(24,32)33)14-6-5-13-27-15-11-20(12-16-27)29-22-7-3-4-8-23(22)34-26(29)31/h3-4,7-10,17-18,20,32-33H,5-6,11-16H2,1-2H3 |
| InChIKey | ZOBUUCAFEYLUOA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|