C24H27N3O5S — CID 18695965
3-[2-methyl-1-[4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one (PubChem CID 18695965) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is 3-[2-methyl-1-[4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[2-methyl-1-[4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 18695965 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 3-[2-methyl-1-[4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one |
| SMILES | CC1CC(n2c(=O)oc3ccccc32)CCN1CCCCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C24H27N3O5S/c1-17-16-18(27-20-9-3-4-10-21(20)32-24(27)29)12-15-25(17)13-6-7-14-26-23(28)19-8-2-5-11-22(19)33(26,30)31/h2-5,8-11,17-18H,6-7,12-16H2,1H3 |
| InChIKey | NYRRGLSIKPPQDL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 92.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|