C22H24N4O5S — CID 19085872
1-[1-[4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-[1,3]oxazolo[5,4-b]pyridin-2-one (PubChem CID 19085872) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is 1-[1-[4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-[1,3]oxazolo[5,4-b]pyridin-2-one.
| Compound Name | 1-[1-[4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-[1,3]oxazolo[5,4-b]pyridin-2-one |
|---|---|
| PubChem CID | 19085872 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 1-[1-[4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]piperidin-4-yl]-[1,3]oxazolo[5,4-b]pyridin-2-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1CCCCN1CCC(n2c(=O)oc3ncccc32)CC1 |
| InChI | InChI=1S/C22H24N4O5S/c27-21-17-6-1-2-8-19(17)32(29,30)25(21)13-4-3-12-24-14-9-16(10-15-24)26-18-7-5-11-23-20(18)31-22(26)28/h1-2,5-8,11,16H,3-4,9-10,12-15H2 |
| InChIKey | CVRAVQAKXLCUGB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|