C28H26ClNO5 — CID 18701958
2-[3-chloro-4-[4-[(3-phenyl-7-prop-2-enyl-1,2-benzoxazol-6-yl)oxy]butoxy]phenyl]acetic acid (PubChem CID 18701958) has the molecular formula C28H26ClNO5 and a molecular weight of 491.97 g/mol. Its IUPAC name is 2-[3-chloro-4-[4-[(3-phenyl-7-prop-2-enyl-1,2-benzoxazol-6-yl)oxy]butoxy]phenyl]acetic acid.
| Compound Name | 2-[3-chloro-4-[4-[(3-phenyl-7-prop-2-enyl-1,2-benzoxazol-6-yl)oxy]butoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 18701958 |
| Molecular Formula | C28H26ClNO5 |
| Molecular Weight | 491.97 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 2-[3-chloro-4-[4-[(3-phenyl-7-prop-2-enyl-1,2-benzoxazol-6-yl)oxy]butoxy]phenyl]acetic acid |
| SMILES | C=CCc1c(OCCCCOc2ccc(CC(=O)O)cc2Cl)ccc2c(-c3ccccc3)noc12 |
| InChI | InChI=1S/C28H26ClNO5/c1-2-8-21-24(14-12-22-27(30-35-28(21)22)20-9-4-3-5-10-20)33-15-6-7-16-34-25-13-11-19(17-23(25)29)18-26(31)32/h2-5,9-14,17H,1,6-8,15-16,18H2,(H,31,32) |
| InChIKey | IFALONQQEGWVPQ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.97 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|