C25H22Cl2O4 — CID 163497951
2-[3-[3-[2-(2,4-dichlorophenoxy)ethyl]-4-prop-2-enoxyphenyl]phenyl]acetic acid (PubChem CID 163497951) has the molecular formula C25H22Cl2O4 and a molecular weight of 457.35 g/mol. Its IUPAC name is 2-[3-[3-[2-(2,4-dichlorophenoxy)ethyl]-4-prop-2-enoxyphenyl]phenyl]acetic acid.
| Compound Name | 2-[3-[3-[2-(2,4-dichlorophenoxy)ethyl]-4-prop-2-enoxyphenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 163497951 |
| Molecular Formula | C25H22Cl2O4 |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 2-[3-[3-[2-(2,4-dichlorophenoxy)ethyl]-4-prop-2-enoxyphenyl]phenyl]acetic acid |
| SMILES | C=CCOc1ccc(-c2cccc(CC(=O)O)c2)cc1CCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H22Cl2O4/c1-2-11-30-23-8-6-19(18-5-3-4-17(13-18)14-25(28)29)15-20(23)10-12-31-24-9-7-21(26)16-22(24)27/h2-9,13,15-16H,1,10-12,14H2,(H,28,29) |
| InChIKey | CSHXJSRCHCHECQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|