C23H22Cl2N2O5 — CID 25263397
2-[3-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-propan-2-yl-1,2-oxazol-3-yl]phenyl]acetic acid (PubChem CID 25263397) has the molecular formula C23H22Cl2N2O5 and a molecular weight of 477.34 g/mol. Its IUPAC name is 2-[3-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-propan-2-yl-1,2-oxazol-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-propan-2-yl-1,2-oxazol-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 25263397 |
| Molecular Formula | C23H22Cl2N2O5 |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 2-[3-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-propan-2-yl-1,2-oxazol-3-yl]phenyl]acetic acid |
| SMILES | CC(C)c1onc(-c2cccc(CC(=O)O)c2)c1C(=O)NCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H22Cl2N2O5/c1-13(2)22-20(21(27-32-22)15-5-3-4-14(10-15)11-19(28)29)23(30)26-8-9-31-18-7-6-16(24)12-17(18)25/h3-7,10,12-13H,8-9,11H2,1-2H3,(H,26,30)(H,28,29) |
| InChIKey | VGDVHUHMEGINCY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|