C26H20Cl2N2O6 — CID 59520412
2-[4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-phenyl-1,2-oxazol-3-yl]phenoxy]acetic acid (PubChem CID 59520412) has the molecular formula C26H20Cl2N2O6 and a molecular weight of 527.36 g/mol. Its IUPAC name is 2-[4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-phenyl-1,2-oxazol-3-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-phenyl-1,2-oxazol-3-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 59520412 |
| Molecular Formula | C26H20Cl2N2O6 |
| Molecular Weight | 527.36 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | 2-[4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-phenyl-1,2-oxazol-3-yl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(-c2noc(-c3ccccc3)c2C(=O)NCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C26H20Cl2N2O6/c27-18-8-11-21(20(28)14-18)34-13-12-29-26(33)23-24(30-36-25(23)17-4-2-1-3-5-17)16-6-9-19(10-7-16)35-15-22(31)32/h1-11,14H,12-13,15H2,(H,29,33)(H,31,32) |
| InChIKey | GJOJKLHJYNNNKK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.36 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|