C27H19Cl2F3N2O5 — CID 11706911
2-[4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-[3-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]phenyl]acetic acid (PubChem CID 11706911) has the molecular formula C27H19Cl2F3N2O5 and a molecular weight of 579.36 g/mol. Its IUPAC name is 2-[4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-[3-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-[3-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 11706911 |
| Molecular Formula | C27H19Cl2F3N2O5 |
| Molecular Weight | 579.36 g/mol |
| Exact Mass | 578.06 |
| IUPAC Name | 2-[4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-[3-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-c2noc(-c3cccc(C(F)(F)F)c3)c2C(=O)NCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C27H19Cl2F3N2O5/c28-19-8-9-21(20(29)14-19)38-11-10-33-26(37)23-24(16-6-4-15(5-7-16)12-22(35)36)34-39-25(23)17-2-1-3-18(13-17)27(30,31)32/h1-9,13-14H,10-12H2,(H,33,37)(H,35,36) |
| InChIKey | CZORZMXVBUAEAX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.36 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|