C24H23ClO5 — CID 59219072
2-[3-[4-[3-(4-chloro-2-methylphenoxy)-2-hydroxypropoxy]phenyl]phenyl]acetic acid (PubChem CID 59219072) has the molecular formula C24H23ClO5 and a molecular weight of 426.90 g/mol. Its IUPAC name is 2-[3-[4-[3-(4-chloro-2-methylphenoxy)-2-hydroxypropoxy]phenyl]phenyl]acetic acid.
| Compound Name | 2-[3-[4-[3-(4-chloro-2-methylphenoxy)-2-hydroxypropoxy]phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 59219072 |
| Molecular Formula | C24H23ClO5 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[3-[4-[3-(4-chloro-2-methylphenoxy)-2-hydroxypropoxy]phenyl]phenyl]acetic acid |
| SMILES | Cc1cc(Cl)ccc1OCC(O)COc1ccc(-c2cccc(CC(=O)O)c2)cc1 |
| InChI | InChI=1S/C24H23ClO5/c1-16-11-20(25)7-10-23(16)30-15-21(26)14-29-22-8-5-18(6-9-22)19-4-2-3-17(12-19)13-24(27)28/h2-12,21,26H,13-15H2,1H3,(H,27,28) |
| InChIKey | VYEWXNHIZAIOOM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |