C14H7F19O2 — CID 18702691
5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-nonadecafluoro-2-methylidenetridecanoic acid (PubChem CID 18702691) has the molecular formula C14H7F19O2 and a molecular weight of 568.17 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-nonadecafluoro-2-methylidenetridecanoic acid.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-nonadecafluoro-2-methylidenetridecanoic acid |
|---|---|
| PubChem CID | 18702691 |
| Molecular Formula | C14H7F19O2 |
| Molecular Weight | 568.17 g/mol |
| Exact Mass | 568.01 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-nonadecafluoro-2-methylidenetridecanoic acid |
| SMILES | C=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C14H7F19O2/c1-4(5(34)35)2-3-6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)13(29,30)14(31,32)33/h1-3H2,(H,34,35) |
| InChIKey | CAKUAGUHUYDFQY-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.17 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|