C18H10F9N3O8S2 — CID 18704221
[1-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dioxo-3-prop-2-ynyl-4-(trifluoromethylsulfonyloxymethyl)imidazolidin-4-yl]methyl trifluoromethanesulfonate (PubChem CID 18704221) has the molecular formula C18H10F9N3O8S2 and a molecular weight of 631.41 g/mol. Its IUPAC name is [1-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dioxo-3-prop-2-ynyl-4-(trifluoromethylsulfonyloxymethyl)imidazolidin-4-yl]methyl trifluoromethanesulfonate.
| Compound Name | [1-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dioxo-3-prop-2-ynyl-4-(trifluoromethylsulfonyloxymethyl)imidazolidin-4-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18704221 |
| Molecular Formula | C18H10F9N3O8S2 |
| Molecular Weight | 631.41 g/mol |
| Exact Mass | 630.98 |
| IUPAC Name | [1-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dioxo-3-prop-2-ynyl-4-(trifluoromethylsulfonyloxymethyl)imidazolidin-4-yl]methyl trifluoromethanesulfonate |
| SMILES | C#CCN1C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)C1(COS(=O)(=O)C(F)(F)F)COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H10F9N3O8S2/c1-2-5-29-14(32)30(11-4-3-10(7-28)12(6-11)16(19,20)21)13(31)15(29,8-37-39(33,34)17(22,23)24)9-38-40(35,36)18(25,26)27/h1,3-4,6H,5,8-9H2 |
| InChIKey | KSRZLKDLXRKMMF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 151.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|