About (4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate
(4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate (PubChem CID 18704792) has the molecular formula C22H21NO5S
and a molecular weight of 411.48 g/mol. Its IUPAC name is (4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate.
Molecular Properties
| Compound Name | (4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate |
| PubChem CID | 18704792 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate |
| SMILES | CC(C)Cc1ccc(-c2ccccc2S(=O)(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H21NO5S/c1-16(2)15-17-7-9-18(10-8-17)21-5-3-4-6-22(21)29(26,27)28-20-13-11-19(12-14-20)23(24)25/h3-14,16H,15H2,1-2H3 |
| InChIKey | RIKWZHVYIBIJMI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate?
The IUPAC name of (4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate (CID 18704792) is (4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate.
What is the SMILES notation for (4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate?
The canonical SMILES for (4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate is CC(C)Cc1ccc(-c2ccccc2S(=O)(=O)Oc2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of (4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate?
The InChIKey is RIKWZHVYIBIJMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO5S/c1-16(2)15-17-7-9-18(10-8-17)21-5-3-4-6-22(21)29(26,27)28-20-13-11-19(12-14-20)23(24)25/h3-14,16H,15H2,1-2H3.
What are the key properties of (4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate?
(4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate has a molecular weight of 411.48 g/mol, XLogP of 5.23, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) 2-[4-(2-methylpropyl)phenyl]benzenesulfonate is sourced from PubChem (CID 18704792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).