About nitrobenzene;(4-nitrophenyl) N-ethylsulfamate
nitrobenzene;(4-nitrophenyl) N-ethylsulfamate (PubChem CID 91268320) has the molecular formula C14H15N3O7S
and a molecular weight of 369.36 g/mol. Its IUPAC name is nitrobenzene;(4-nitrophenyl) N-ethylsulfamate.
Molecular Properties
| Compound Name | nitrobenzene;(4-nitrophenyl) N-ethylsulfamate |
| PubChem CID | 91268320 |
| Molecular Formula | C14H15N3O7S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | nitrobenzene;(4-nitrophenyl) N-ethylsulfamate |
| SMILES | CCNS(=O)(=O)Oc1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C8H10N2O5S.C6H5NO2/c1-2-9-16(13,14)15-8-5-3-7(4-6-8)10(11)12;8-7(9)6-4-2-1-3-5-6/h3-6,9H,2H2,1H3;1-5H |
| InChIKey | FMDSTEDQTWJFFC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrobenzene;(4-nitrophenyl) N-ethylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrobenzene;(4-nitrophenyl) N-ethylsulfamate?
The IUPAC name of nitrobenzene;(4-nitrophenyl) N-ethylsulfamate (CID 91268320) is nitrobenzene;(4-nitrophenyl) N-ethylsulfamate.
What is the SMILES notation for nitrobenzene;(4-nitrophenyl) N-ethylsulfamate?
The canonical SMILES for nitrobenzene;(4-nitrophenyl) N-ethylsulfamate is CCNS(=O)(=O)Oc1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1ccccc1.
What is the InChIKey of nitrobenzene;(4-nitrophenyl) N-ethylsulfamate?
The InChIKey is FMDSTEDQTWJFFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O5S.C6H5NO2/c1-2-9-16(13,14)15-8-5-3-7(4-6-8)10(11)12;8-7(9)6-4-2-1-3-5-6/h3-6,9H,2H2,1H3;1-5H.
What are the key properties of nitrobenzene;(4-nitrophenyl) N-ethylsulfamate?
nitrobenzene;(4-nitrophenyl) N-ethylsulfamate has a molecular weight of 369.36 g/mol, XLogP of 2.42, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for nitrobenzene;(4-nitrophenyl) N-ethylsulfamate is sourced from PubChem (CID 91268320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).