C14H23N3O7S — CID 110191135
N,N-diethylethanamine;methyl N-(4-nitrophenoxy)sulfonylcarbamate (PubChem CID 110191135) has the molecular formula C14H23N3O7S and a molecular weight of 377.42 g/mol. Its IUPAC name is N,N-diethylethanamine;methyl N-(4-nitrophenoxy)sulfonylcarbamate.
| Compound Name | N,N-diethylethanamine;methyl N-(4-nitrophenoxy)sulfonylcarbamate |
|---|---|
| PubChem CID | 110191135 |
| Molecular Formula | C14H23N3O7S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N,N-diethylethanamine;methyl N-(4-nitrophenoxy)sulfonylcarbamate |
| SMILES | CCN(CC)CC.COC(=O)NS(=O)(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H8N2O7S.C6H15N/c1-16-8(11)9-18(14,15)17-7-4-2-6(3-5-7)10(12)13;1-4-7(5-2)6-3/h2-5H,1H3,(H,9,11);4-6H2,1-3H3 |
| InChIKey | ADAMCCMKUPEOIY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|