About 1-pyrrol-1-ylimidazole
1-pyrrol-1-ylimidazole (PubChem CID 18707113) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 1-pyrrol-1-ylimidazole.
Molecular Properties
| Compound Name | 1-pyrrol-1-ylimidazole |
| PubChem CID | 18707113 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 1-pyrrol-1-ylimidazole |
| SMILES | c1ccn(-n2ccnc2)c1 |
| InChI | InChI=1S/C7H7N3/c1-2-5-9(4-1)10-6-3-8-7-10/h1-7H |
| InChIKey | DRXBWIALCFTJKL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-pyrrol-1-ylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrol-1-ylimidazole?
The IUPAC name of 1-pyrrol-1-ylimidazole (CID 18707113) is 1-pyrrol-1-ylimidazole.
What is the SMILES notation for 1-pyrrol-1-ylimidazole?
The canonical SMILES for 1-pyrrol-1-ylimidazole is c1ccn(-n2ccnc2)c1.
What is the InChIKey of 1-pyrrol-1-ylimidazole?
The InChIKey is DRXBWIALCFTJKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-2-5-9(4-1)10-6-3-8-7-10/h1-7H.
What are the key properties of 1-pyrrol-1-ylimidazole?
1-pyrrol-1-ylimidazole has a molecular weight of 133.15 g/mol, XLogP of 1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrol-1-ylimidazole is sourced from PubChem (CID 18707113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).