C6H6N4O2S3 — CID 18707687
5-methylsulfonyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-thiazole (PubChem CID 18707687) has the molecular formula C6H6N4O2S3 and a molecular weight of 262.34 g/mol. Its IUPAC name is 5-methylsulfonyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-thiazole.
| Compound Name | 5-methylsulfonyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-thiazole |
|---|---|
| PubChem CID | 18707687 |
| Molecular Formula | C6H6N4O2S3 |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 5-methylsulfonyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-thiazole |
| SMILES | CS(=O)(=O)c1cnc(Sc2ncn[nH]2)s1 |
| InChI | InChI=1S/C6H6N4O2S3/c1-15(11,12)4-2-7-6(13-4)14-5-8-3-9-10-5/h2-3H,1H3,(H,8,9,10) |
| InChIKey | HGAQXWMZQRGBHG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|