C6H7N5O2S3 — CID 18707702
5-methylsulfonyl-2-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazole (PubChem CID 18707702) has the molecular formula C6H7N5O2S3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 5-methylsulfonyl-2-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazole.
| Compound Name | 5-methylsulfonyl-2-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazole |
|---|---|
| PubChem CID | 18707702 |
| Molecular Formula | C6H7N5O2S3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 5-methylsulfonyl-2-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazole |
| SMILES | Cn1nnnc1Sc1ncc(S(C)(=O)=O)s1 |
| InChI | InChI=1S/C6H7N5O2S3/c1-11-5(8-9-10-11)15-6-7-3-4(14-6)16(2,12)13/h3H,1-2H3 |
| InChIKey | RZPOLSBQLCWQDE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|