C8H11N5O2S3 — CID 18708383
5-methylsulfonyl-2-(2-propan-2-yltetrazol-5-yl)sulfanyl-1,3-thiazole (PubChem CID 18708383) has the molecular formula C8H11N5O2S3 and a molecular weight of 305.41 g/mol. Its IUPAC name is 5-methylsulfonyl-2-(2-propan-2-yltetrazol-5-yl)sulfanyl-1,3-thiazole.
| Compound Name | 5-methylsulfonyl-2-(2-propan-2-yltetrazol-5-yl)sulfanyl-1,3-thiazole |
|---|---|
| PubChem CID | 18708383 |
| Molecular Formula | C8H11N5O2S3 |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 5-methylsulfonyl-2-(2-propan-2-yltetrazol-5-yl)sulfanyl-1,3-thiazole |
| SMILES | CC(C)n1nnc(Sc2ncc(S(C)(=O)=O)s2)n1 |
| InChI | InChI=1S/C8H11N5O2S3/c1-5(2)13-11-7(10-12-13)17-8-9-4-6(16-8)18(3,14)15/h4-5H,1-3H3 |
| InChIKey | IASQWURQLNLWJK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|