C21H16ClNO3 — CID 18709786
4-[5-(7-chloro-5-ethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid (PubChem CID 18709786) has the molecular formula C21H16ClNO3 and a molecular weight of 365.82 g/mol. Its IUPAC name is 4-[5-(7-chloro-5-ethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid.
| Compound Name | 4-[5-(7-chloro-5-ethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 18709786 |
| Molecular Formula | C21H16ClNO3 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 4-[5-(7-chloro-5-ethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid |
| SMILES | CCc1cc(Cl)c2oc(-c3ccc(-c4ccc(C(=O)O)cc4)[nH]3)cc2c1 |
| InChI | InChI=1S/C21H16ClNO3/c1-2-12-9-15-11-19(26-20(15)16(22)10-12)18-8-7-17(23-18)13-3-5-14(6-4-13)21(24)25/h3-11,23H,2H2,1H3,(H,24,25) |
| InChIKey | JVLNIUUYEXZNLM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |