C25H40O4 — CID 18709892
(4E,6E)-9-[(6-hydroxy-1,8a-dimethyl-7-prop-1-en-2-yl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl)oxy]deca-4,6-diene-2,8-diol (PubChem CID 18709892) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is (4E,6E)-9-[(6-hydroxy-1,8a-dimethyl-7-prop-1-en-2-yl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl)oxy]deca-4,6-diene-2,8-diol.
| Compound Name | (4E,6E)-9-[(6-hydroxy-1,8a-dimethyl-7-prop-1-en-2-yl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl)oxy]deca-4,6-diene-2,8-diol |
|---|---|
| PubChem CID | 18709892 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (4E,6E)-9-[(6-hydroxy-1,8a-dimethyl-7-prop-1-en-2-yl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl)oxy]deca-4,6-diene-2,8-diol |
| SMILES | C=C(C)C1CC2(C)C(=CC1O)CCC(OC(C)C(O)/C=C/C=C/CC(C)O)C2C |
| InChI | InChI=1S/C25H40O4/c1-16(2)21-15-25(6)18(4)24(13-12-20(25)14-23(21)28)29-19(5)22(27)11-9-7-8-10-17(3)26/h7-9,11,14,17-19,21-24,26-28H,1,10,12-13,15H2,2-6H3/b8-7+,11-9+ |
| InChIKey | JMWHJYNQGLLXSS-MFDVASPDSA-N |
| XLogP | 4.32 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|