C26H40O5 — CID 54234450
(6-hydroxy-1,8a-dimethyl-7-prop-1-en-2-yl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl) 3,9-dihydroxy-2-methyldeca-4,6-dienoate (PubChem CID 54234450) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is (6-hydroxy-1,8a-dimethyl-7-prop-1-en-2-yl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl) 3,9-dihydroxy-2-methyldeca-4,6-dienoate.
| Compound Name | (6-hydroxy-1,8a-dimethyl-7-prop-1-en-2-yl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl) 3,9-dihydroxy-2-methyldeca-4,6-dienoate |
|---|---|
| PubChem CID | 54234450 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | (6-hydroxy-1,8a-dimethyl-7-prop-1-en-2-yl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl) 3,9-dihydroxy-2-methyldeca-4,6-dienoate |
| SMILES | C=C(C)C1CC2(C)C(=CC1O)CCC(OC(=O)C(C)C(O)C=CC=CCC(C)O)C2C |
| InChI | InChI=1S/C26H40O5/c1-16(2)21-15-26(6)19(5)24(13-12-20(26)14-23(21)29)31-25(30)18(4)22(28)11-9-7-8-10-17(3)27/h7-9,11,14,17-19,21-24,27-29H,1,10,12-13,15H2,2-6H3 |
| InChIKey | QLOHOILEZBAWOV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|