C16H20F3NO2 — CID 18709951
N,2,2,4-tetramethyl-3-oxo-N-[4-(trifluoromethyl)phenyl]pentanamide (PubChem CID 18709951) has the molecular formula C16H20F3NO2 and a molecular weight of 315.34 g/mol. Its IUPAC name is N,2,2,4-tetramethyl-3-oxo-N-[4-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | N,2,2,4-tetramethyl-3-oxo-N-[4-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 18709951 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N,2,2,4-tetramethyl-3-oxo-N-[4-(trifluoromethyl)phenyl]pentanamide |
| SMILES | CC(C)C(=O)C(C)(C)C(=O)N(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H20F3NO2/c1-10(2)13(21)15(3,4)14(22)20(5)12-8-6-11(7-9-12)16(17,18)19/h6-10H,1-5H3 |
| InChIKey | PQNIOYCXUOIJIR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|